| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() | www.bocsci.com | |||
![]() | +1 (631) 485-4226 | |||
![]() | +1 (631) 614-7828 | |||
![]() | info@bocsci.com | |||
| Chemical manufacturer | ||||
| chemBlink Standard supplier since 2010 | ||||
| Classification | API >> Inhibitor drug |
|---|---|
| Name | 3-amino-N-(1,3-benzodioxol-5-ylmethyl)-4,6-dimethylthieno[2,3-b]pyridine-2-carboxamide |
| Synonyms | VU0152099 |
| Molecular Structure | ![]() |
| Molecular Formula | C18H17N3O3S |
| Molecular Weight | 355.41 |
| CAS Registry Number | 612514-42-8 |
| SMILES | CC1=CC(=NC2=C1C(=C(S2)C(=O)NCC3=CC4=C(C=C3)OCO4)N)C |
| Solubility | 189.1 mg/L (25 °C water) |
|---|---|
| Density | 1.4±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.708, Calc.* |
| Melting point | 249.93 °C |
| Boiling Point | 622.9±55.0 °C (760 mmHg), Calc.*, 579.91 °C |
| Flash Point | 330.5±31.5 °C, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols | |
|---|---|
| Risk Statements | H315-H319 Details |
| Safety Statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 Details |
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for 3-amino-N-(1,3-benzodioxol-5-ylmethyl)-4,6-dimethylthieno[2,3-b]pyridine-2-carboxamide |