|
CAS#: 95080-43-6 Product: 2-Amino-3-(1,3-benzodioxol-5-yl)-2-methylpropanamide No suppilers available for the product. |
| Name | 2-Amino-3-(1,3-benzodioxol-5-yl)-2-methylpropanamide |
|---|---|
| Synonyms | 2-Amino-2-methyl-(3-(3,4-methylenedioxyphenyl))propanamide; 3-(2H-ben |
| Molecular Structure | ![]() |
| Molecular Formula | C11H14N2O3 |
| Molecular Weight | 222.24 |
| CAS Registry Number | 95080-43-6 |
| SMILES | O=C(N)C(N)(C)Cc1ccc2OCOc2c1 |
| InChI | 1S/C11H14N2O3/c1-11(13,10(12)14)5-7-2-3-8-9(4-7)16-6-15-8/h2-4H,5-6,13H2,1H3,(H2,12,14) |
| InChIKey | VDMUWWOTFCARHH-UHFFFAOYSA-N |
| Density | 1.3g/cm3 (Cal.) |
|---|---|
| Boiling point | 427.378°C at 760 mmHg (Cal.) |
| Flash point | 231.737°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Amino-3-(1,3-benzodioxol-5-yl)-2-methylpropanamide |