|
CAS#: 612545-94-5 Product: 6-Chloro-1-(4-piperidinyl)-1,4-dihydro-2H-3,1-benzoxazin-2-one hydrochloride (1:1) No suppilers available for the product. |
| Name | 6-Chloro-1-(4-piperidinyl)-1,4-dihydro-2H-3,1-benzoxazin-2-one hydrochloride (1:1) |
|---|---|
| Synonyms | 6-Chloro- |
| Molecular Formula | C13H16Cl2N2O2 |
| Molecular Weight | 303.18 |
| CAS Registry Number | 612545-94-5 |
| SMILES | Cl.Clc1ccc2N(C(=O)OCc2c1)C3CCNCC3 |
| InChI | 1S/C13H15ClN2O2.ClH/c14-10-1-2-12-9(7-10)8-18-13(17)16(12)11-3-5-15-6-4-11;/h1-2,7,11,15H,3-6,8H2;1H |
| InChIKey | YXBCITKHTVCJGR-UHFFFAOYSA-N |
| Boiling point | 442.6°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 221.5°C (Cal.) |
| Refractive index | (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Chloro-1-(4-piperidinyl)-1,4-dihydro-2H-3,1-benzoxazin-2-one hydrochloride (1:1) |