Online Database of Chemicals from Around the World
|
CAS#: 78750-03-5 Product: 5-Chloro-2-Piperidin-1-Yl-1,3-Benzoxazole No suppilers available for the product. |
| Name | 5-Chloro-2-Piperidin-1-Yl-1,3-Benzoxazole |
|---|---|
| Synonyms | 5-Chloro-2-(1-Piperidyl)-1,3-Benzoxazole; 5-Chloro-2-Piperidino-1,3-Benzoxazole; Nsc24975 |
| Molecular Structure |  |
| Molecular Formula | C12H13ClN2O |
| Molecular Weight | 236.70 |
| CAS Registry Number | 78750-03-5 |
| SMILES | C1=C(Cl)C=CC2=C1N=C(O2)N3CCCCC3 |
| InChI | 1S/C12H13ClN2O/c13-9-4-5-11-10(8-9)14-12(16-11)15-6-2-1-3-7-15/h4-5,8H,1-3,6-7H2 |
| InChIKey | YGFYTUACVRNBRK-UHFFFAOYSA-N |
| Density | 1.288g/cm3 (Cal.) |
|---|---|
| Boiling point | 356.768°C at 760 mmHg (Cal.) |
| Flash point | 169.568°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Chloro-2-Piperidin-1-Yl-1,3-Benzoxazole |