Online Database of Chemicals from Around the World
|
CAS#: 61293-22-9 Product: 7-Hydroxyflumequine No suppilers available for the product. |
| Name | 7-Hydroxyflumequine |
|---|---|
| Synonyms | 7-Hydroxyflumequine |
| Molecular Structure |  |
| Molecular Formula | C14H12FNO4 |
| Molecular Weight | 277.25 |
| CAS Registry Number | 61293-22-9 |
| SMILES | C1=C(F)C=C3C2=C1C(=O)C(=CN2C(CC3O)C)C(=O)O |
| InChI | 1S/C14H12FNO4/c1-6-2-11(17)8-3-7(15)4-9-12(8)16(6)5-10(13(9)18)14(19)20/h3-6,11,17H,2H2,1H3,(H,19,20) |
| InChIKey | JTYQHEUSQWIRBH-UHFFFAOYSA-N |
| Density | 1.562g/cm3 (Cal.) |
|---|---|
| Boiling point | 457.747°C at 760 mmHg (Cal.) |
| Flash point | 230.638°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 7-Hydroxyflumequine |