|
CAS#: 613-65-0 Product: 4-(N,N-Dimethylamino)Benzeneazo-2-Naphthalene No suppilers available for the product. |
| Name | 4-(N,N-Dimethylamino)Benzeneazo-2-Naphthalene |
|---|---|
| Synonyms | N,N-Dimethyl-4-(2-Naphthylazo)Aniline; Dimethyl-[4-(2-Naphthylazo)Phenyl]Amine; N,N-Dimethyl-4-Naphthalen-2-Yldiazenyl-Aniline |
| Molecular Structure | ![]() |
| Molecular Formula | C18H17N3 |
| Molecular Weight | 275.35 |
| CAS Registry Number | 613-65-0 |
| SMILES | C1=C3C(=CC=C1N=NC2=CC=C(N(C)C)C=C2)C=CC=C3 |
| InChI | 1S/C18H17N3/c1-21(2)18-11-9-16(10-12-18)19-20-17-8-7-14-5-3-4-6-15(14)13-17/h3-13H,1-2H3 |
| InChIKey | RGYAGKVUDLVFOW-UHFFFAOYSA-N |
| Density | 1.079g/cm3 (Cal.) |
|---|---|
| Boiling point | 461.584°C at 760 mmHg (Cal.) |
| Flash point | 232.958°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(N,N-Dimethylamino)Benzeneazo-2-Naphthalene |