Online Database of Chemicals from Around the World
|
CAS#: 6143-53-9 Product: Hexamethylenediammonium Dinitrate No suppilers available for the product. |
| Name | Hexamethylenediammonium Dinitrate |
|---|---|
| Synonyms | 6-Aminohexylamine; Nitric Acid; Hexamethylenediammonium Dinitrate |
| Molecular Structure |  |
| Molecular Formula | C6H18N4O6 |
| Molecular Weight | 242.23 |
| CAS Registry Number | 6143-53-9 |
| EINECS | 228-145-7 |
| SMILES | O=[N+]([O-])O.O=[N+]([O-])O.C(CCCN)CCN |
| InChI | 1S/C6H16N2.2HNO3/c7-5-3-1-2-4-6-8;2*2-1(3)4/h1-8H2;2*(H,2,3,4) |
| InChIKey | BQWJJCWXFPJLBK-UHFFFAOYSA-N |
| Boiling point | 205°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 81.1°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Hexamethylenediammonium Dinitrate |