Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 9-Anthryloxirane |
|---|---|
| Synonyms | 2-(9-Anthryl)Oxirane; 9-Anthryloxirane; Anthracene, 9-(Epoxyethyl)- |
| Molecular Structure |  |
| Molecular Formula | C16H12O |
| Molecular Weight | 220.27 |
| CAS Registry Number | 61695-73-6 |
| SMILES | C1=C2C(=CC=C1)C(=C3C(=C2)C=CC=C3)C4OC4 |
| InChI | 1S/C16H12O/c1-3-7-13-11(5-1)9-12-6-2-4-8-14(12)16(13)15-10-17-15/h1-9,15H,10H2 |
| InChIKey | WSQHNGOQXGWRRF-UHFFFAOYSA-N |
| Density | 1.247g/cm3 (Cal.) |
|---|---|
| Boiling point | 420.7°C at 760 mmHg (Cal.) |
| Flash point | 198.318°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 9-Anthryloxirane |