Online Database of Chemicals from Around the World
|
CAS#: 61702-91-8 Product: 5-(Tert-Butyl)Quinoline No suppilers available for the product. |
| Name | 5-(Tert-Butyl)Quinoline |
|---|---|
| Synonyms | (Tert-Butyl)Quinoline; Quinoline, (1,1-Dimethylethyl)- |
| Molecular Structure |  |
| Molecular Formula | C13H15N |
| Molecular Weight | 185.27 |
| CAS Registry Number | 61702-91-8 |
| EINECS | 262-927-9 |
| SMILES | C2=CC=C1N=CC=CC1=C2C(C)(C)C |
| InChI | 1S/C13H15N/c1-13(2,3)11-7-4-8-12-10(11)6-5-9-14-12/h4-9H,1-3H3 |
| InChIKey | CWVYYJOLOZEZOF-UHFFFAOYSA-N |
| Density | 1.01g/cm3 (Cal.) |
|---|---|
| Boiling point | 286.174°C at 760 mmHg (Cal.) |
| Flash point | 116.346°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-(Tert-Butyl)Quinoline |