Online Database of Chemicals from Around the World
| Otava Ltd. | Ukraine | Inquire | ||
|---|---|---|---|---|
 |
+380 (44) 522-2458 | |||
 |
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| Name | 8-Tert-Butylquinoline |
|---|---|
| Synonyms | 8-(Tert-Butyl)Quinoline |
| Molecular Structure |  |
| Molecular Formula | C13H15N |
| Molecular Weight | 185.27 |
| CAS Registry Number | 75413-96-6 |
| EINECS | 278-200-4 |
| SMILES | C1=NC2=C(C=C1)C=CC=C2C(C)(C)C |
| InChI | 1S/C13H15N/c1-13(2,3)11-8-4-6-10-7-5-9-14-12(10)11/h4-9H,1-3H3 |
| InChIKey | OQKVXNPHJMUXOZ-UHFFFAOYSA-N |
| Density | 1.01g/cm3 (Cal.) |
|---|---|
| Boiling point | 286.174°C at 760 mmHg (Cal.) |
| Flash point | 116.346°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 8-Tert-Butylquinoline |