Online Database of Chemicals from Around the World
|
CAS#: 61735-77-1 Product: 3-Fluorobenzo(a,i)Pyrene No suppilers available for the product. |
| Name | 3-Fluorobenzo(a,i)Pyrene |
|---|---|
| Synonyms | Brn 1995992; 3-Fluorobenzo(A,I)Pyrene; 3-Fluorobenzo(Rst)Pentaphene |
| Molecular Structure |  |
| Molecular Formula | C24H13F |
| Molecular Weight | 320.37 |
| CAS Registry Number | 61735-77-1 |
| SMILES | C1=C(F)C=C2C(=C1)C6=C3C(=C2)C=CC4=C3C(=C5C(=C4)C=CC=C5)C=C6 |
| InChI | 1S/C24H13F/c25-18-7-8-20-17(13-18)12-16-6-5-15-11-14-3-1-2-4-19(14)21-9-10-22(20)24(16)23(15)21/h1-13H |
| InChIKey | RFZRVBKLYCYBKA-UHFFFAOYSA-N |
| Density | 1.367g/cm3 (Cal.) |
|---|---|
| Boiling point | 554.789°C at 760 mmHg (Cal.) |
| Flash point | 251.949°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Fluorobenzo(a,i)Pyrene |