Online Database of Chemicals from Around the World
|
CAS#: 73368-38-4 Product: 2-Fluorobenzo(a,i)Pyrene No suppilers available for the product. |
| Name | 2-Fluorobenzo(a,i)Pyrene |
|---|---|
| Synonyms | 2-Fluorobenzo(Rst)Pentaphene; 2-Fluorobenzopentaphene; Benzo(Rst)Pentaphene, 2-Fluoro- |
| Molecular Structure |  |
| Molecular Formula | C24H13F |
| Molecular Weight | 320.37 |
| CAS Registry Number | 73368-38-4 |
| SMILES | C1=C(F)C=CC2=C1C6=C3C(=C2)C=CC4=C3C(=C5C(=C4)C=CC=C5)C=C6 |
| InChI | 1S/C24H13F/c25-18-8-7-15-12-17-6-5-16-11-14-3-1-2-4-19(14)20-9-10-21(22(15)13-18)24(17)23(16)20/h1-13H |
| InChIKey | GJZRFPBONYKDPS-UHFFFAOYSA-N |
| Density | 1.367g/cm3 (Cal.) |
|---|---|
| Boiling point | 554.789°C at 760 mmHg (Cal.) |
| Flash point | 251.949°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Fluorobenzo(a,i)Pyrene |