Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Sigma-Aldrich, Inc. | USA | Inquire | ||
|---|---|---|---|---|
|
+86 (21) 6141-5566 / 800-819-3336 | |||
|
ordercn@sial.com, | |||
| Chemical manufacturer since 1992 | ||||
| Name | 1,2,4,5-Benzenetetracarboxamide |
|---|---|
| Synonyms | Pyromellitamide; St5319705; 1,2,4,5-Benzenetetracarboxamide |
| Molecular Structure |  |
| Molecular Formula | C10H10N4O4 |
| Molecular Weight | 250.21 |
| CAS Registry Number | 6183-35-3 |
| SMILES | C1=C(C(N)=O)C(=CC(=C1C(N)=O)C(N)=O)C(N)=O |
| InChI | 1S/C10H10N4O4/c11-7(15)3-1-4(8(12)16)6(10(14)18)2-5(3)9(13)17/h1-2H,(H2,11,15)(H2,12,16)(H2,13,17)(H2,14,18) |
| InChIKey | FGLFAMLQSRIUFO-UHFFFAOYSA-N |
| Density | 1.523g/cm3 (Cal.) |
|---|---|
| Boiling point | 517.273°C at 760 mmHg (Cal.) |
| Flash point | 266.637°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1,2,4,5-Benzenetetracarboxamide |