Online Database of Chemicals from Around the World
|
CAS#: 6207-55-2 Product: 3,6-Di-O-Methylglucose No suppilers available for the product. |
| Name | 3,6-Di-O-Methylglucose |
|---|---|
| Synonyms | (2R,3S,4R,5R)-2,4,5-Trihydroxy-3,6-Dimethoxy-Hexanal; 3,6-Di-O-Methylglucose; 3,6-Dmg |
| Molecular Structure |  |
| Molecular Formula | C8H16O6 |
| Molecular Weight | 208.21 |
| CAS Registry Number | 6207-55-2 |
| SMILES | [C@@H](C=O)(O)[C@@H](OC)[C@H](O)[C@H](O)COC |
| InChI | 1S/C8H16O6/c1-13-4-6(11)7(12)8(14-2)5(10)3-9/h3,5-8,10-12H,4H2,1-2H3/t5-,6+,7+,8+/m0/s1 |
| InChIKey | GEYWNKDRHKUEJL-LXGUWJNJSA-N |
| Density | 1.265g/cm3 (Cal.) |
|---|---|
| Boiling point | 407.026°C at 760 mmHg (Cal.) |
| Flash point | 162.663°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,6-Di-O-Methylglucose |