| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Santa Cruz Biotechnology, Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (831) 457-3800 | |||
![]() |
scbt@scbt.com | |||
| Chemical manufacturer | ||||
| Classification | Biochemical >> Amino acids and their derivatives >> Glutamic acid derivative |
|---|---|
| Name | 4,4-Dimethyl-L-Glutamic Acid |
| Synonyms | 4-Dimethyl-L-glutamic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C7H13NO4 |
| Molecular Weight | 175.18 |
| CAS Registry Number | 151139-88-7 |
| SMILES | O=C(O)[C@@H](N)CC(C(=O)O)(C)C |
| InChI | 1S/C7H13NO4/c1-7(2,6(11)12)3-4(8)5(9)10/h4H,3,8H2,1-2H3,(H,9,10)(H,11,12)/t4-/m0/s1 |
| InChIKey | HDVPVAJBJJYYBO-BYPYZUCNSA-N |
| Density | 1.275g/cm3 (Cal.) |
|---|---|
| Boiling point | 329.896°C at 760 mmHg (Cal.) |
| Flash point | 153.316°C (Cal.) |
| Refractive index | 1.509 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,4-Dimethyl-L-Glutamic Acid |