Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 3,5-Dimethylbicyclo[4.2.0]octa-1,3,5-trien-7-yl acetate |
|---|---|
| Synonyms | 3,5-dimethylbicyclo[4.2.0]octa-1,3,5-trien-7-yl acetate |
| Molecular Structure | ![CAS#: 627528-53-4， 3,5-Dimethylbicyclo[4.2.0]octa-1,3,5-trien-7-yl acetate](/moreStructures/627528-53-4.gif) |
| Molecular Formula | C12H14O2 |
| Molecular Weight | 190.24 |
| CAS Registry Number | 627528-53-4 |
| SMILES | Cc1cc(c2c(c1)CC2OC(=O)C)C |
| InChI | 1S/C12H14O2/c1-7-4-8(2)12-10(5-7)6-11(12)14-9(3)13/h4-5,11H,6H2,1-3H3 |
| InChIKey | SFLYWKASXVHNBI-UHFFFAOYSA-N |
| Density | 1.102g/cm3 (Cal.) |
|---|---|
| Boiling point | 278.274°C at 760 mmHg (Cal.) |
| Flash point | 114.192°C (Cal.) |
| Refractive index | 1.542 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,5-Dimethylbicyclo[4.2.0]octa-1,3,5-trien-7-yl acetate |