Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 4,5-Dimethyl-1H,1'H-2,2'-biimidazol-1-ol |
|---|---|
| Synonyms | 4,5-dimethyl-1H,1'H-[2,2'-biimidazol]-1-ol |
| Molecular Structure |  |
| Molecular Formula | C8H10N4O |
| Molecular Weight | 178.19 |
| CAS Registry Number | 954145-27-8 |
| SMILES | Cc1c(n(c(n1)c2[nH]ccn2)O)C |
| InChI | 1S/C8H10N4O/c1-5-6(2)12(13)8(11-5)7-9-3-4-10-7/h3-4,13H,1-2H3,(H,9,10) |
| InChIKey | UDTNNXJPIVEMOF-UHFFFAOYSA-N |
| Density | 1.428g/cm3 (Cal.) |
|---|---|
| Boiling point | 513.252°C at 760 mmHg (Cal.) |
| Flash point | 264.206°C (Cal.) |
| Refractive index | 1.694 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,5-Dimethyl-1H,1'H-2,2'-biimidazol-1-ol |