Online Database of Chemicals from Around the World
|
CAS#: 62987-63-7 Product: Benzo(c)Phenanthrene 3,4-Oxide No suppilers available for the product. |
| Name | Benzo(c)Phenanthrene 3,4-Oxide |
|---|---|
| Synonyms | Benzo(C)Phenanthrene 3,4-Oxide; Bpa-3,4-Epoxide |
| Molecular Structure |  |
| Molecular Formula | C18H12O |
| Molecular Weight | 244.29 |
| CAS Registry Number | 62987-63-7 |
| SMILES | C3=C2C1OC1C=CC2=C4C(=C3)C=CC5=CC=CC=C45 |
| InChI | 1S/C18H12O/c1-2-4-13-11(3-1)5-6-12-7-8-15-14(17(12)13)9-10-16-18(15)19-16/h1-10,16,18H |
| InChIKey | IYUXRXMUTZPKFB-UHFFFAOYSA-N |
| Density | 1.302g/cm3 (Cal.) |
|---|---|
| Boiling point | 473.743°C at 760 mmHg (Cal.) |
| Flash point | 226.122°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Benzo(c)Phenanthrene 3,4-Oxide |