Online Database of Chemicals from Around the World
|
CAS#: 71382-54-2 Product: Benzo(c)Phenanthrene-5,6-Imine No suppilers available for the product. |
| Name | Benzo(c)Phenanthrene-5,6-Imine |
|---|---|
| Synonyms | Brn 4454549; Benzo(C)Phenanthrene-5,6-Imine; Ccris 6810 |
| Molecular Structure |  |
| Molecular Formula | C18H13N |
| Molecular Weight | 243.31 |
| CAS Registry Number | 71382-54-2 |
| SMILES | C2=CC1=CC=C4C(=C1C=C2)C3=C(C=CC=C3)C5C4N5 |
| InChI | 1S/C18H13N/c1-2-6-12-11(5-1)9-10-15-16(12)13-7-3-4-8-14(13)17-18(15)19-17/h1-10,17-19H |
| InChIKey | JMHJDDCGYRIRMY-UHFFFAOYSA-N |
| Density | 1.248g/cm3 (Cal.) |
|---|---|
| Boiling point | 442.539°C at 760 mmHg (Cal.) |
| Flash point | 244.442°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Benzo(c)Phenanthrene-5,6-Imine |