Online Database of Chemicals from Around the World
|
CAS#: 6365-50-0 Product: 3-(2-Quinolylmethylene)Phthalide No suppilers available for the product. |
| Name | 3-(2-Quinolylmethylene)Phthalide |
|---|---|
| Synonyms | (3E)-3-(2-Quinolylmethylene)Isobenzofuran-1-One; (3E)-3-(2-Quinolylmethylene)-1-Isobenzofuranone; 3-(2-Quinolylmethylene)Phthalide |
| Molecular Structure |  |
| Molecular Formula | C18H11NO2 |
| Molecular Weight | 273.29 |
| CAS Registry Number | 6365-50-0 |
| EINECS | 228-857-8 |
| SMILES | C1=CC=CC2=C1\C(OC2=O)=C/C4=NC3=CC=CC=C3C=C4 |
| InChI | 1S/C18H11NO2/c20-18-15-7-3-2-6-14(15)17(21-18)11-13-10-9-12-5-1-4-8-16(12)19-13/h1-11H/b17-11+ |
| InChIKey | CXPDELLOVTUCGG-GZTJUZNOSA-N |
| Density | 1.358g/cm3 (Cal.) |
|---|---|
| Boiling point | 468.53°C at 760 mmHg (Cal.) |
| Flash point | 237.159°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(2-Quinolylmethylene)Phthalide |