Online Database of Chemicals from Around the World
|
CAS#: 63956-90-1 Product: Tert-Amyl 2-Furylcarbamate No suppilers available for the product. |
| Name | Tert-Amyl 2-Furylcarbamate |
|---|---|
| Synonyms | 2,2-Dimethylpropyl N-(2-Furyl)Carbamate; N-(2-Furyl)Carbamic Acid 2,2-Dimethylpropyl Ester; N-(2-Furyl)Carbamic Acid Neopentyl Ester |
| Molecular Structure |  |
| Molecular Formula | C10H15NO3 |
| Molecular Weight | 197.23 |
| CAS Registry Number | 63956-90-1 |
| SMILES | C1=C(NC(OCC(C)(C)C)=O)OC=C1 |
| InChI | 1S/C10H15NO3/c1-10(2,3)7-14-9(12)11-8-5-4-6-13-8/h4-6H,7H2,1-3H3,(H,11,12) |
| InChIKey | XECPEDLWCKINAV-UHFFFAOYSA-N |
| Density | 1.11g/cm3 (Cal.) |
|---|---|
| Boiling point | 225.766°C at 760 mmHg (Cal.) |
| Flash point | 90.34°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Tert-Amyl 2-Furylcarbamate |