|
CAS#: 63992-41-6 Product: 6-Chloro-2-phenylphenol, sodium salt No suppilers available for the product. |
| Name | 6-Chloro-2-phenylphenol, sodium salt |
|---|---|
| Synonyms | Sodium 3-Chloro-2-Phenyl-Phenolate; Sodium-2-Chloro-6-Phenyl Phenate; Stop-Mold |
| Molecular Structure | ![]() |
| Molecular Formula | C12H8ClNaO |
| Molecular Weight | 226.64 |
| CAS Registry Number | 63992-41-6 |
| SMILES | C1=C(Cl)C(=C([O-])C=C1)C2=CC=CC=C2.[Na+] |
| InChI | 1S/C12H9ClO.Na/c13-10-7-4-8-11(14)12(10)9-5-2-1-3-6-9;/h1-8,14H;/q;+1/p-1 |
| InChIKey | SPJMAPNWDLIVRR-UHFFFAOYSA-M |
| Boiling point | 304°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 137.6°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Chloro-2-phenylphenol, sodium salt |