Online Database of Chemicals from Around the World
|
CAS#: 7469-95-6 Product: 1-(2-Chlorophenyl)-2-Phenanthridin-6-Yl-Ethanone No suppilers available for the product. |
| Name | 1-(2-Chlorophenyl)-2-Phenanthridin-6-Yl-Ethanone |
|---|---|
| Synonyms | 1-(2-Chlorophenyl)-2-Phenanthridin-6-Yl-Ethanone; 1-(2-Chlorophenyl)-2-(6-Phenanthridinyl)Ethanone; Nsc402313 |
| Molecular Structure |  |
| Molecular Formula | C21H14ClNO |
| Molecular Weight | 331.80 |
| CAS Registry Number | 7469-95-6 |
| SMILES | C4=CC2=C(N=C(CC(=O)C1=C(C=CC=C1)Cl)C3=C2C=CC=C3)C=C4 |
| InChI | 1S/C21H14ClNO/c22-18-11-5-3-10-17(18)21(24)13-20-16-9-2-1-7-14(16)15-8-4-6-12-19(15)23-20/h1-12H,13H2 |
| InChIKey | PKRVDSLMRDEHOI-UHFFFAOYSA-N |
| Density | 1.301g/cm3 (Cal.) |
|---|---|
| Boiling point | 502.583°C at 760 mmHg (Cal.) |
| Flash point | 257.753°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(2-Chlorophenyl)-2-Phenanthridin-6-Yl-Ethanone |