Online Database of Chemicals from Around the World
|
CAS#: 64036-88-0 Product: 4,4-Dimethyl-1-(1,1,3,3-Tetramethylbutyl)-2-Imidazolidinethione No suppilers available for the product. |
| Name | 4,4-Dimethyl-1-(1,1,3,3-Tetramethylbutyl)-2-Imidazolidinethione |
|---|---|
| Synonyms | 4,4-Dimethyl-1-(1,1,3,3-Tetramethylbutyl)Imidazolidine-2-Thione; 4,4-Dimethyl-1-(1,1,3,3-Tetramethylbutyl)-2-Imidazolidinethione; 1-(1,1,3,3-Tetramethylbutyl)-4,4-Dimethyl-2-Imidazolidinethione |
| Molecular Structure |  |
| Molecular Formula | C13H26N2S |
| Molecular Weight | 242.42 |
| CAS Registry Number | 64036-88-0 |
| SMILES | C(C(N1C(NC(C1)(C)C)=S)(C)C)C(C)(C)C |
| InChI | 1S/C13H26N2S/c1-11(2,3)8-13(6,7)15-9-12(4,5)14-10(15)16/h8-9H2,1-7H3,(H,14,16) |
| InChIKey | TUDXUTBWUKMCSB-UHFFFAOYSA-N |
| Density | 0.989g/cm3 (Cal.) |
|---|---|
| Boiling point | 288.072°C at 760 mmHg (Cal.) |
| Flash point | 128.022°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,4-Dimethyl-1-(1,1,3,3-Tetramethylbutyl)-2-Imidazolidinethione |