|
CAS#: 86436-38-6 Product: 2,2-Dimethyl-N-[(7S)-1,2,3,10-tetramethoxy-9-oxo-5,6,7,9-tetrahydrobenzo[a]heptalen-7-yl]propanamide No suppilers available for the product. |
| Name | 2,2-Dimethyl-N-[(7S)-1,2,3,10-tetramethoxy-9-oxo-5,6,7,9-tetrahydrobenzo[a]heptalen-7-yl]propanamide |
|---|---|
| Synonyms | 2,2-Dimet |
| Molecular Structure | ![]() |
| Molecular Formula | C25H31NO6 |
| Molecular Weight | 441.52 |
| CAS Registry Number | 86436-38-6 |
| SMILES | CC(C)(C)C(=O)N[C@H]1CCC2=CC(=C(C(=C2C3=CC=C(C(=O)C=C13)OC)OC)OC)OC |
| InChI | 1S/C25H31NO6/c1-25(2,3)24(28)26-17-10-8-14-12-20(30-5)22(31-6)23(32-7)21(14)15-9-11-19(29-4)18(27)13-16(15)17/h9,11-13,17H,8,10H2,1-7H3,(H,26,28)/t17-/m0/s1 |
| InChIKey | ADAQEBBJZRFNQW-KRWDZBQOSA-N |
| Density | 1.2±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 724.0±60.0°C at 760 mmHg (Cal.) |
| Flash point | 391.7±32.9°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,2-Dimethyl-N-[(7S)-1,2,3,10-tetramethoxy-9-oxo-5,6,7,9-tetrahydrobenzo[a]heptalen-7-yl]propanamide |