Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 1-Hydrazinoanthraquinone |
|---|---|
| Synonyms | 1-Hydrazinoanthracene-9,10-Dione; 1-Hydrazino-9,10-Anthraquinone; 9,10-Anthracenedione, 1-Hydrazino- |
| Molecular Structure |  |
| Molecular Formula | C14H10N2O2 |
| Molecular Weight | 238.25 |
| CAS Registry Number | 6407-59-6 |
| SMILES | C1=CC2=C(C=C1)C(=O)C3=C(C2=O)C=CC=C3NN |
| InChI | 1S/C14H10N2O2/c15-16-11-7-3-6-10-12(11)14(18)9-5-2-1-4-8(9)13(10)17/h1-7,16H,15H2 |
| InChIKey | JISJFZUSRPVXMI-UHFFFAOYSA-N |
| Density | 1.438g/cm3 (Cal.) |
|---|---|
| Boiling point | 477.382°C at 760 mmHg (Cal.) |
| Flash point | 242.512°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Hydrazinoanthraquinone |