Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| C D N Isotopes Inc. | Canada | Inquire | ||
|---|---|---|---|---|
|
+1 (800) 565-4696 / (514) 697-6254 | |||
|
info@cdnisotopes.com, | |||
| Chemical manufacturer since 1993 | ||||
| Name | (2,2-2H2)Octanoic acid |
|---|---|
| Synonyms | [156779-05-4]; [64118-36-1]; Caprylic acid |
| Molecular Structure |  |
| Molecular Formula | C8H14D2O2 |
| Molecular Weight | 146.22 |
| CAS Registry Number | 64118-36-1 |
| SMILES | [2H]C([2H])(CCCCCC)C(=O)O |
| InChI | 1S/C8H16O2/c1-2-3-4-5-6-7-8(9)10/h2-7H2,1H3,(H,9,10)/i7D2 |
| InChIKey | WWZKQHOCKIZLMA-RJSZUWSASA-N |
| Density | 0.942g/cm3 (Cal.) |
|---|---|
| Melting point | 16°C (Expl.) |
| Boiling point | 239.33°C at 760 mmHg (Cal.) |
| Flash point | 107.379°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2,2-2H2)Octanoic acid |