Online Database of Chemicals from Around the World
|
CAS#: 64291-96-9 Product: 3-Methyl-2-(p-Tolyl)Pyridine No suppilers available for the product. |
| Name | 3-Methyl-2-(p-Tolyl)Pyridine |
|---|---|
| Synonyms | 3-Methyl-2-(P-Tolyl)Pyridine |
| Molecular Structure |  |
| Molecular Formula | C13H13N |
| Molecular Weight | 183.25 |
| CAS Registry Number | 64291-96-9 |
| EINECS | 264-771-7 |
| SMILES | C1=CC=C(C(=N1)C2=CC=C(C=C2)C)C |
| InChI | 1S/C13H13N/c1-10-5-7-12(8-6-10)13-11(2)4-3-9-14-13/h3-9H,1-2H3 |
| InChIKey | RYRDKQYQAMRCHF-UHFFFAOYSA-N |
| Density | 1.015g/cm3 (Cal.) |
|---|---|
| Boiling point | 285.954°C at 760 mmHg (Cal.) |
| Flash point | 117.769°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Methyl-2-(p-Tolyl)Pyridine |