Online Database of Chemicals from Around the World
| Leap Chem Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 (852) 3060-6658 | |||
 |
market19@leapchem.com | |||
 |
QQ Chat | |||
| Chemical distributor since 2006 | ||||
| chemBlink standard supplier since 2022 | ||||
| Name | 5-Methyl-2-(p-Tolyl)Pyridine |
|---|---|
| Synonyms | 5-Methyl-2-(P-Tolyl)Pyridine |
| Molecular Structure |  |
| Molecular Formula | C13H13N |
| Molecular Weight | 183.25 |
| CAS Registry Number | 85237-71-4 |
| EINECS | 286-432-2 |
| SMILES | C1=C(C=CC(=N1)C2=CC=C(C=C2)C)C |
| InChI | 1S/C13H13N/c1-10-3-6-12(7-4-10)13-8-5-11(2)9-14-13/h3-9H,1-2H3 |
| InChIKey | PTBRNAVGPWOGSE-UHFFFAOYSA-N |
| Density | 1.015g/cm3 (Cal.) |
|---|---|
| Boiling point | 301.709°C at 760 mmHg (Cal.) |
| Flash point | 127.088°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Methyl-2-(p-Tolyl)Pyridine |