Online Database of Chemicals from Around the World
|
CAS#: 64693-50-1 Product: 1-Nitro-D-Proline No suppilers available for the product. |
| Name | 1-Nitro-D-Proline |
|---|---|
| Synonyms | (2R)-1-Nitro-2-Pyrrolidinecarboxylic Acid; (2R)-1-Nitroproline; 1-Nitro-D-Proline |
| Molecular Structure |  |
| Molecular Formula | C5H8N2O4 |
| Molecular Weight | 160.13 |
| CAS Registry Number | 64693-50-1 |
| SMILES | [C@H]1(N([N+]([O-])=O)CCC1)C(=O)O |
| InChI | 1S/C5H8N2O4/c8-5(9)4-2-1-3-6(4)7(10)11/h4H,1-3H2,(H,8,9)/t4-/m1/s1 |
| InChIKey | CSDIOFGVLSDOSG-SCSAIBSYSA-N |
| Density | 1.492g/cm3 (Cal.) |
|---|---|
| Boiling point | 435.021°C at 760 mmHg (Cal.) |
| Flash point | 216.893°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Nitro-D-Proline |