Online Database of Chemicals from Around the World
|
CAS#: 64727-64-6 Product: 9-cis-Lycopene No suppilers available for the product. |
| Name | 9-cis-Lycopene |
|---|---|
| Synonyms | 9-Cis-Psu,Psi-Carotene; Psi,Psi-Carotene, 9-Cis- |
| Molecular Structure |  |
| Molecular Formula | C40H56 |
| Molecular Weight | 536.88 |
| CAS Registry Number | 64727-64-6 |
| SMILES | C(C=C(C)C)C\C(=C\C=C\C(=C/C=C/C(=C/C=C/C=C(/C=C/C=C(/C=C/C=C(/CCC=C(C)C)C)C)C)C)C)C |
| InChI | 1S/C40H56/c1-33(2)19-13-23-37(7)27-17-31-39(9)29-15-25-35(5)21-11-12-22-36(6)26-16-30-40(10)32-18-28-38(8)24-14-20-34(3)4/h11-12,15-22,25-32H,13-14,23-24H2,1-10H3/b12-11+,25-15+,26-16+,31-17+,32-18+,35-21+,36-22+,37-27+,38-28+,39-29-,40-30+ |
| InChIKey | OAIJSZIZWZSQBC-CBEQXLMWSA-N |
| Density | 0.889g/cm3 (Cal.) |
|---|---|
| Boiling point | 660.905°C at 760 mmHg (Cal.) |
| Flash point | 350.736°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 9-cis-Lycopene |