Online Database of Chemicals from Around the World
| Name | Trimethylammonium Methyl Sulphate |
|---|---|
| Synonyms | Decyl-Trimethyl-Ammonium; Methyl Sulfate; Decyl-Trimethylammonium; Methyl Sulfate; Decyl-Trimethyl-Azanium; Methyl Sulfate |
| Molecular Structure |  |
| Molecular Formula | C14H33NO4S |
| Molecular Weight | 311.48 |
| CAS Registry Number | 65059-98-5 |
| EINECS | 265-351-6 |
| SMILES | C(C)CCCCCCCC[N+](C)(C)C.CO[S]([O-])(=O)=O |
| InChI | 1S/C13H30N.CH4O4S/c1-5-6-7-8-9-10-11-12-13-14(2,3)4;1-5-6(2,3)4/h5-13H2,1-4H3;1H3,(H,2,3,4)/q+1;/p-1 |
| InChIKey | KAOPHVRFVWFGRN-UHFFFAOYSA-M |
| Market Analysis Reports |
| List of Reports Available for Trimethylammonium Methyl Sulphate |
