Online Database of Chemicals from Around the World
|
CAS#: 90370-29-9 Product: 4,4',6-Trimethylangelicin No suppilers available for the product. |
| Name | 4,4',6-Trimethylangelicin |
|---|---|
| Synonyms | 4,6,9-Trimethyl-2-Furo[2,3-H]Chromenone; 2H-Furo(2,3-H)(1)Benzopyran-2-One, 4,6,9-Trimethyl, Plus Ultraviolet A Radiation; 2H-Furo(2,3-H)-1-Benzopyran-2-One, 4,6,9-Trimethyl- |
| Molecular Structure |  |
| Molecular Formula | C14H12O3 |
| Molecular Weight | 228.25 |
| CAS Registry Number | 90370-29-9 |
| SMILES | C1=C3C(=C2C(=C1C)OC=C2C)OC(=O)C=C3C |
| InChI | 1S/C14H12O3/c1-7-5-11(15)17-14-10(7)4-8(2)13-12(14)9(3)6-16-13/h4-6H,1-3H3 |
| InChIKey | ZARUKNQGJBWWBA-UHFFFAOYSA-N |
| Density | 1.237g/cm3 (Cal.) |
|---|---|
| Boiling point | 397.232°C at 760 mmHg (Cal.) |
| Flash point | 194.039°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,4',6-Trimethylangelicin |