| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 6-Sec-Butylquinoline |
|---|---|
| Synonyms | 6-Sec-Butylquinoline; 6- And 8-Sec-Butylquinoline (80/20) |
| Molecular Structure | ![]() |
| Molecular Formula | C13H15N |
| Molecular Weight | 185.27 |
| CAS Registry Number | 65442-31-1 |
| EINECS | 265-777-2 |
| SMILES | C1=CC(=CC2=CC=CN=C12)C(CC)C |
| InChI | 1S/C13H15N/c1-3-10(2)11-6-7-13-12(9-11)5-4-8-14-13/h4-10H,3H2,1-2H3 |
| InChIKey | AUBLFWWZTFFBNU-UHFFFAOYSA-N |
| Density | 1.01g/cm3 (Cal.) |
|---|---|
| Boiling point | 288.295°C at 760 mmHg (Cal.) |
| Flash point | 117.583°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Sec-Butylquinoline |