Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 8-(Sec-Butyl)Quinoline |
|---|---|
| Synonyms | 8-Sec-Butylquinoline; 8-(Sec-Butyl)Quinoline |
| Molecular Structure |  |
| Molecular Formula | C13H15N |
| Molecular Weight | 185.27 |
| CAS Registry Number | 67634-06-4 |
| EINECS | 266-809-8 |
| SMILES | C1=CC=C2C(=N1)C(=CC=C2)C(CC)C |
| InChI | 1S/C13H15N/c1-3-10(2)12-8-4-6-11-7-5-9-14-13(11)12/h4-10H,3H2,1-2H3 |
| InChIKey | UNHPNXMTAQYTRG-UHFFFAOYSA-N |
| Density | 1.01g/cm3 (Cal.) |
|---|---|
| Boiling point | 288.295°C at 760 mmHg (Cal.) |
| Flash point | 117.583°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 8-(Sec-Butyl)Quinoline |