Online Database of Chemicals from Around the World
| Name | 2,7-Dibromodibenzofuran |
|---|---|
| Synonyms | Dibenzofuran, 2,7-Dibromo-; 2,7-Dibromo-Dibenzofuran |
| Molecular Structure |  |
| Molecular Formula | C12H6Br2O |
| Molecular Weight | 325.99 |
| CAS Registry Number | 65489-80-7 |
| SMILES | C1=C3C(=CC(=C1)Br)C2=CC=C(C=C2O3)Br |
| InChI | 1S/C12H6Br2O/c13-7-2-4-11-10(5-7)9-3-1-8(14)6-12(9)15-11/h1-6H |
| InChIKey | VRGIPEHRKNLRIY-UHFFFAOYSA-N |
| Density | 1.886g/cm3 (Cal.) |
|---|---|
| Boiling point | 396.049°C at 760 mmHg (Cal.) |
| Flash point | 193.324°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,7-Dibromodibenzofuran |
