Online Database of Chemicals from Around the World
| Sigma-Aldrich, Inc. | USA | Inquire | ||
|---|---|---|---|---|
 |
+86 (21) 6141-5566 / 800-819-3336 | |||
 |
ordercn@sial.com, | |||
| Chemical manufacturer since 1992 | ||||
| Name | 2,5-Dibromo-4-(decyloxy)phenol |
|---|---|
| Synonyms | 2,5-Dibromo-4-(decyloxy)phenol; 630543_ALDRICH |
| Molecular Structure |  |
| Molecular Formula | C16H24Br2O2 |
| Molecular Weight | 408.17 |
| CAS Registry Number | 870703-49-4 |
| SMILES | Brc1cc(O)c(Br)cc1OCCCCCCCCCC |
| InChI | 1S/C16H24Br2O2/c1-2-3-4-5-6-7-8-9-10-20-16-12-13(17)15(19)11-14(16)18/h11-12,19H,2-10H2,1H3 |
| InChIKey | SSEJKDGLNTZULX-UHFFFAOYSA-N |
| Density | 1.394g/cm3 (Cal.) |
|---|---|
| Boiling point | 417.362°C at 760 mmHg (Cal.) |
| Flash point | 206.214°C (Cal.) |
| Refractive index | 1.54 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,5-Dibromo-4-(decyloxy)phenol |