| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| DSL Chemicals (Shanghai) Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (21) 6352-9955 | |||
![]() |
info@dsl-chem.com | |||
| Chemical manufacturer since 1997 | ||||
| SL Drugs and Pharmaceuticals Pvt. Ltd. | India | Inquire | ||
|---|---|---|---|---|
![]() |
+91 (40) 6661-1133 | |||
![]() |
enquiry@sldrugs.com | |||
| Chemical distributor since 1999 | ||||
| Name | 4-Fluoro Benzylamine Hydrochloride |
|---|---|
| Synonyms | (4-Fluorobenzyl)Amine Hydrochloride; P-Fluorobenzylamine Hydrochloride; St5411988 |
| Molecular Formula | C7H9ClFN |
| Molecular Weight | 161.61 |
| CAS Registry Number | 659-41-6 |
| EINECS | 211-534-0 |
| SMILES | [H+].C1=C(CN)C=CC(=C1)F.[Cl-] |
| InChI | 1S/C7H8FN.ClH/c8-7-3-1-6(5-9)2-4-7;/h1-4H,5,9H2;1H |
| InChIKey | TXMNQIDABVFSRY-UHFFFAOYSA-N |
| Boiling point | 184.3°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 73.3°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 4-Fluoro Benzylamine Hydrochloride |