Online Database of Chemicals from Around the World
| Otava Ltd. | Ukraine | Inquire | ||
|---|---|---|---|---|
 |
+380 (44) 522-2458 | |||
 |
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| Name | 3',4'-Methylenedioxyisobutyrophenone |
|---|---|
| Synonyms | 1-(1,3-Benzodioxol-5-Yl)-2-Methyl-Propan-1-One; Isobutyrophenone, 3',4'-(Methylenedioxy)-; 3',4'-(Methylenedioxy)Isobutyrophenone |
| Molecular Structure |  |
| Molecular Formula | C11H12O3 |
| Molecular Weight | 192.21 |
| CAS Registry Number | 67292-69-7 |
| SMILES | C1=C2C(=CC=C1C(C(C)C)=O)OCO2 |
| InChI | 1S/C11H12O3/c1-7(2)11(12)8-3-4-9-10(5-8)14-6-13-9/h3-5,7H,6H2,1-2H3 |
| InChIKey | DEKHBCCIHCQNFM-UHFFFAOYSA-N |
| Density | 1.161g/cm3 (Cal.) |
|---|---|
| Boiling point | 311.671°C at 760 mmHg (Cal.) |
| Flash point | 133.254°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3',4'-Methylenedioxyisobutyrophenone |