Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 5-(1,4-Diazabicyclo[3.1.1]hept-4-yl)nicotinonitrile |
|---|---|
| Synonyms | 5-(1,4-diazabicyclo[3.1.1]heptan-4-yl)nicotinonitrile |
| Molecular Structure | ![CAS#: 675591-33-0， 5-(1,4-Diazabicyclo[3.1.1]hept-4-yl)nicotinonitrile](/moreStructures/675591-33-0.gif) |
| Molecular Formula | C11H12N4 |
| Molecular Weight | 200.24 |
| CAS Registry Number | 675591-33-0 |
| SMILES | N#Cc1cc(cnc1)N3C2CN(C2)CC3 |
| InChI | 1S/C11H12N4/c12-4-9-3-10(6-13-5-9)15-2-1-14-7-11(15)8-14/h3,5-6,11H,1-2,7-8H2 |
| InChIKey | ROAGTWAERUMAGC-UHFFFAOYSA-N |
| Density | 1.325g/cm3 (Cal.) |
|---|---|
| Boiling point | 374.632°C at 760 mmHg (Cal.) |
| Flash point | 180.371°C (Cal.) |
| Refractive index | 1.662 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-(1,4-Diazabicyclo[3.1.1]hept-4-yl)nicotinonitrile |