Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
|
+86 13417589054/ | |||
|
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 2,3-Diazabicyclo[2.2.1]hept-5-ene-2,3-dicarboxylic acid |
|---|---|
| Synonyms | 2,3-diazabicyclo[2.2.1]hept-5-ene-2,3-dicarboxylic acid; 2,3-DIAZABICYCLO[2.2.1]HEPT-5-ENE-2,3-DICARBOXYLICACID |
| Molecular Structure | ![CAS#: 740060-59-7， 2,3-Diazabicyclo[2.2.1]hept-5-ene-2,3-dicarboxylic acid](/moreStructures/740060-59-7.gif) |
| Molecular Formula | C7H8N2O4 |
| Molecular Weight | 184.15 |
| CAS Registry Number | 740060-59-7 |
| SMILES | C1C2C=CC1N(N2C(=O)O)C(=O)O |
| InChI | 1S/C7H8N2O4/c10-6(11)8-4-1-2-5(3-4)9(8)7(12)13/h1-2,4-5H,3H2,(H,10,11)(H,12,13) |
| InChIKey | SEULEVHUEBOMFH-UHFFFAOYSA-N |
| Density | 1.752g/cm3 (Cal.) |
|---|---|
| Boiling point | 395.735°C at 760 mmHg (Cal.) |
| Flash point | 193.134°C (Cal.) |
| Refractive index | 1.687 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,3-Diazabicyclo[2.2.1]hept-5-ene-2,3-dicarboxylic acid |