Online Database of Chemicals from Around the World
|
CAS#: 67977-01-9 Product: 10-Azabenzo(a)Pyrene 4,5-Oxide No suppilers available for the product. |
| Name | 10-Azabenzo(a)Pyrene 4,5-Oxide |
|---|---|
| Synonyms | Oxireno(2,3)Phenaleno(1,9-Gh)Quinoline, 3B,4A-Dihydro- |
| Molecular Structure |  |
| Molecular Formula | C19H11NO |
| Molecular Weight | 269.30 |
| CAS Registry Number | 67977-01-9 |
| SMILES | C6=C5C2=C(C1OC1C4=C2C(=C3N=CC=CC3=C4)C=C5)C=C6 |
| InChI | 1S/C19H11NO/c1-3-10-6-7-12-16-14(9-11-4-2-8-20-17(11)12)19-18(21-19)13(5-1)15(10)16/h1-9,18-19H |
| InChIKey | QDFSNNRULRMSIH-UHFFFAOYSA-N |
| Density | 1.447g/cm3 (Cal.) |
|---|---|
| Boiling point | 534.127°C at 760 mmHg (Cal.) |
| Flash point | 188.079°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 10-Azabenzo(a)Pyrene 4,5-Oxide |