Online Database of Chemicals from Around the World
|
CAS#: 68400-52-2 Product: 2-Hydroxy-2-Methyl-4'-Propylpropiophenone No suppilers available for the product. |
| Name | 2-Hydroxy-2-Methyl-4'-Propylpropiophenone |
|---|---|
| Synonyms | 1-(4'-Propylphenyl)-2-Hydroxy-2-Methylpropanone-1; 1-Propanone, 2-Hydroxy-2-Methyl-1-(4-Propylphenyl)-; 2-Hydroxy-2-Methyl-4'-Propylpropiophenone |
| Molecular Structure |  |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.28 |
| CAS Registry Number | 68400-52-2 |
| EINECS | 270-041-9 |
| SMILES | C1=C(C=CC(=C1)C(=O)C(O)(C)C)CCC |
| InChI | 1S/C13H18O2/c1-4-5-10-6-8-11(9-7-10)12(14)13(2,3)15/h6-9,15H,4-5H2,1-3H3 |
| InChIKey | VOGSBOVWPQXXAH-UHFFFAOYSA-N |
| Density | 1.027g/cm3 (Cal.) |
|---|---|
| Boiling point | 325.836°C at 760 mmHg (Cal.) |
| Flash point | 138.337°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Hydroxy-2-Methyl-4'-Propylpropiophenone |