Online Database of Chemicals from Around the World
|
CAS#: 93962-73-3 Product: 3-Hydroxy-1-Methylpropyl Salicylate No suppilers available for the product. |
| Name | 3-Hydroxy-1-Methylpropyl Salicylate |
|---|---|
| Synonyms | (3-Hydroxy-1-Methyl-Propyl) 2-Hydroxybenzoate; 2-Hydroxybenzoic Acid (3-Hydroxy-1-Methylpropyl) Ester; 2-Hydroxybenzoic Acid (3-Hydroxy-1-Methyl-Propyl) Ester |
| Molecular Structure |  |
| Molecular Formula | C11H14O4 |
| Molecular Weight | 210.23 |
| CAS Registry Number | 93962-73-3 |
| EINECS | 300-711-9 |
| SMILES | C1=C(C(OC(CCO)C)=O)C(=CC=C1)O |
| InChI | 1S/C11H14O4/c1-8(6-7-12)15-11(14)9-4-2-3-5-10(9)13/h2-5,8,12-13H,6-7H2,1H3 |
| InChIKey | JJQLRJLJGKELCO-UHFFFAOYSA-N |
| Density | 1.214g/cm3 (Cal.) |
|---|---|
| Boiling point | 344.875°C at 760 mmHg (Cal.) |
| Flash point | 132.346°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Hydroxy-1-Methylpropyl Salicylate |