|
CAS#: 685871-07-2 Product: 1-Piperazinyl{4-[3-(1-piperidinyl)propoxy]phenyl}methanone No suppilers available for the product. |
| Name | 1-Piperazinyl{4-[3-(1-piperidinyl)propoxy]phenyl}methanone |
|---|---|
| Synonyms | PIPERAZIN |
| Molecular Structure | ![]() |
| Molecular Formula | C19H29N3O2 |
| Molecular Weight | 331.45 |
| CAS Registry Number | 685871-07-2 |
| SMILES | O=C(N1CCNCC1)c3ccc(OCCCN2CCCCC2)cc3 |
| InChI | 1S/C19H29N3O2/c23-19(22-14-9-20-10-15-22)17-5-7-18(8-6-17)24-16-4-13-21-11-2-1-3-12-21/h5-8,20H,1-4,9-16H2 |
| InChIKey | DNXMPQYULGRSIC-UHFFFAOYSA-N |
| Density | 1.101g/cm3 (Cal.) |
|---|---|
| Boiling point | 515.944°C at 760 mmHg (Cal.) |
| Flash point | 265.833°C (Cal.) |
| Refractive index | 1.548 (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1-Piperazinyl{4-[3-(1-piperidinyl)propoxy]phenyl}methanone |