Online Database of Chemicals from Around the World
|
CAS#: 68921-92-6 Product: 3-(2,4-Dichlorophenyl)Lactic Acid No suppilers available for the product. |
| Name | 3-(2,4-Dichlorophenyl)Lactic Acid |
|---|---|
| Synonyms | 3-(2,4-Dichlorophenyl)-2-Hydroxy-Propanoic Acid; 3-(2,4-Dichlorophenyl)-2-Hydroxy-Propionic Acid |
| Molecular Structure |  |
| Molecular Formula | C9H8Cl2O3 |
| Molecular Weight | 235.07 |
| CAS Registry Number | 68921-92-6 |
| EINECS | 272-968-4 |
| SMILES | C1=C(Cl)C(=CC=C1Cl)CC(O)C(=O)O |
| InChI | 1S/C9H8Cl2O3/c10-6-2-1-5(7(11)4-6)3-8(12)9(13)14/h1-2,4,8,12H,3H2,(H,13,14) |
| InChIKey | NBORNXKEEFIAMC-UHFFFAOYSA-N |
| Density | 1.515g/cm3 (Cal.) |
|---|---|
| Boiling point | 390.728°C at 760 mmHg (Cal.) |
| Flash point | 190.105°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(2,4-Dichlorophenyl)Lactic Acid |