Online Database of Chemicals from Around the World
| Name | 1-(2,6-Dichlorophenyl)-3-Isopropylurea |
|---|---|
| Synonyms | 3-(2,6-Dichlorophenyl)-1-Isopropyl-Urea; 3-(2,6-Dichlorophenyl)-1-Isopropylurea; 3-(2,6-Dichlorophenyl)-1-Propan-2-Yl-Urea |
| Molecular Structure |  |
| Molecular Formula | C10H12Cl2N2O |
| Molecular Weight | 247.12 |
| CAS Registry Number | 71463-57-5 |
| EINECS | 275-496-7 |
| SMILES | C1=CC=C(C(=C1Cl)NC(NC(C)C)=O)Cl |
| InChI | 1S/C10H12Cl2N2O/c1-6(2)13-10(15)14-9-7(11)4-3-5-8(9)12/h3-6H,1-2H3,(H2,13,14,15) |
| InChIKey | VMPFTLYFFVBBES-UHFFFAOYSA-N |
| Density | 1.31g/cm3 (Cal.) |
|---|---|
| Boiling point | 310.442°C at 760 mmHg (Cal.) |
| Flash point | 141.551°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1-(2,6-Dichlorophenyl)-3-Isopropylurea |
