| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Classification | Analytical chemistry >> Standard >> Food and beverage standards |
|---|---|
| Name | 2,3,5,6-Tetrachloroanisole |
| Synonyms | 1,2,4,5-Tetrachloro-3-Methoxy-Benzene; Anisole, 2,3,5,6-Tetrachloro-; Benzene, 1,2,4,5-Tetrachloro-3-Methoxy- |
| Molecular Structure | ![]() |
| Molecular Formula | C7H4Cl4O |
| Molecular Weight | 245.92 |
| CAS Registry Number | 6936-40-9 |
| EINECS | 230-061-0 |
| SMILES | C1=C(C(=C(C(=C1Cl)Cl)OC)Cl)Cl |
| InChI | 1S/C7H4Cl4O/c1-12-7-5(10)3(8)2-4(9)6(7)11/h2H,1H3 |
| InChIKey | WMMFIDNWZNCBCT-UHFFFAOYSA-N |
| Density | 1.525g/cm3 (Cal.) |
|---|---|
| Boiling point | 286.929°C at 760 mmHg (Cal.) |
| Flash point | 113.568°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 2,3,5,6-Tetrachloroanisole |