Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 2,3,4,5-Tetrachloroanisole |
|---|---|
| Synonyms | 1,2,3,4-Tetrachloro-5-Methoxy-Benzene; Benzene, 1,2,3,4-Tetrachloro-5-Methoxy- |
| Molecular Structure |  |
| Molecular Formula | C7H4Cl4O |
| Molecular Weight | 245.92 |
| CAS Registry Number | 938-86-3 |
| EINECS | 213-349-0 |
| SMILES | C1=C(C(=C(C(=C1Cl)Cl)Cl)Cl)OC |
| InChI | 1S/C7H4Cl4O/c1-12-4-2-3(8)5(9)7(11)6(4)10/h2H,1H3 |
| InChIKey | FUUHMSUPRUNWRQ-UHFFFAOYSA-N |
| Density | 1.525g/cm3 (Cal.) |
|---|---|
| Boiling point | 294.178°C at 760 mmHg (Cal.) |
| Flash point | 117.571°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 2,3,4,5-Tetrachloroanisole |