Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | Methyl 2-methyl-D-asparaginate |
|---|---|
| Synonyms | (R)-methyl 2,4-diamino-2-methyl-4-oxobutanoate |
| Molecular Structure |  |
| Molecular Formula | C6H12N2O3 |
| Molecular Weight | 160.17 |
| CAS Registry Number | 693771-70-9 |
| SMILES | C[C@@](CC(=O)N)(C(=O)OC)N |
| InChI | 1S/C6H12N2O3/c1-6(8,3-4(7)9)5(10)11-2/h3,8H2,1-2H3,(H2,7,9)/t6-/m1/s1 |
| InChIKey | CTMNHIFTGPSQFP-ZCFIWIBFSA-N |
| Density | 1.181g/cm3 (Cal.) |
|---|---|
| Boiling point | 326.219°C at 760 mmHg (Cal.) |
| Flash point | 182.526°C (Cal.) |
| Refractive index | 1.483 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl 2-methyl-D-asparaginate |